C19H16F3NO4 — CID 90957439
methyl 1-hydroxy-7-methyl-2-[[4-(trifluoromethoxy)phenyl]methyl]isoindole-5-carboxylate (PubChem CID 90957439) has the molecular formula C19H16F3NO4 and a molecular weight of 379.33 g/mol. Its IUPAC name is methyl 1-hydroxy-7-methyl-2-[[4-(trifluoromethoxy)phenyl]methyl]isoindole-5-carboxylate.
| Compound Name | methyl 1-hydroxy-7-methyl-2-[[4-(trifluoromethoxy)phenyl]methyl]isoindole-5-carboxylate |
|---|---|
| PubChem CID | 90957439 |
| Molecular Formula | C19H16F3NO4 |
| Molecular Weight | 379.33 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | methyl 1-hydroxy-7-methyl-2-[[4-(trifluoromethoxy)phenyl]methyl]isoindole-5-carboxylate |
| SMILES | COC(=O)c1cc(C)c2c(O)n(Cc3ccc(OC(F)(F)F)cc3)cc2c1 |
| InChI | InChI=1S/C19H16F3NO4/c1-11-7-13(18(25)26-2)8-14-10-23(17(24)16(11)14)9-12-3-5-15(6-4-12)27-19(20,21)22/h3-8,10,24H,9H2,1-2H3 |
| InChIKey | HPMRQAQHWIRIEO-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.33 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |