C17H10F4N2O2 — CID 91353191
6-fluoro-3-hydroxy-2-[[4-(trifluoromethoxy)phenyl]methyl]isoindole-4-carbonitrile (PubChem CID 91353191) has the molecular formula C17H10F4N2O2 and a molecular weight of 350.27 g/mol. Its IUPAC name is 6-fluoro-3-hydroxy-2-[[4-(trifluoromethoxy)phenyl]methyl]isoindole-4-carbonitrile.
| Compound Name | 6-fluoro-3-hydroxy-2-[[4-(trifluoromethoxy)phenyl]methyl]isoindole-4-carbonitrile |
|---|---|
| PubChem CID | 91353191 |
| Molecular Formula | C17H10F4N2O2 |
| Molecular Weight | 350.27 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | 6-fluoro-3-hydroxy-2-[[4-(trifluoromethoxy)phenyl]methyl]isoindole-4-carbonitrile |
| SMILES | N#Cc1cc(F)cc2cn(Cc3ccc(OC(F)(F)F)cc3)c(O)c12 |
| InChI | InChI=1S/C17H10F4N2O2/c18-13-5-11(7-22)15-12(6-13)9-23(16(15)24)8-10-1-3-14(4-2-10)25-17(19,20)21/h1-6,9,24H,8H2 |
| InChIKey | LHJGFUFXSQIPQN-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 58.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.27 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |