C10H7F5O4 — CID 170998746
2-[2-(difluoromethoxy)-4-(trifluoromethoxy)phenyl]acetic acid (PubChem CID 170998746) has the molecular formula C10H7F5O4 and a molecular weight of 286.15 g/mol. Its IUPAC name is 2-[2-(difluoromethoxy)-4-(trifluoromethoxy)phenyl]acetic acid.
| Compound Name | 2-[2-(difluoromethoxy)-4-(trifluoromethoxy)phenyl]acetic acid |
|---|---|
| PubChem CID | 170998746 |
| Molecular Formula | C10H7F5O4 |
| Molecular Weight | 286.15 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | 2-[2-(difluoromethoxy)-4-(trifluoromethoxy)phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(OC(F)(F)F)cc1OC(F)F |
| InChI | InChI=1S/C10H7F5O4/c11-9(12)18-7-4-6(19-10(13,14)15)2-1-5(7)3-8(16)17/h1-2,4,9H,3H2,(H,16,17) |
| InChIKey | ROLWPURISJSIJI-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.15 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |