C10H10F5NO2 — CID 165350168
2-(difluoromethoxy)-N,N-dimethyl-4-(trifluoromethoxy)aniline (PubChem CID 165350168) has the molecular formula C10H10F5NO2 and a molecular weight of 271.19 g/mol. Its IUPAC name is 2-(difluoromethoxy)-N,N-dimethyl-4-(trifluoromethoxy)aniline.
| Compound Name | 2-(difluoromethoxy)-N,N-dimethyl-4-(trifluoromethoxy)aniline |
|---|---|
| PubChem CID | 165350168 |
| Molecular Formula | C10H10F5NO2 |
| Molecular Weight | 271.19 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 2-(difluoromethoxy)-N,N-dimethyl-4-(trifluoromethoxy)aniline |
| SMILES | CN(C)c1ccc(OC(F)(F)F)cc1OC(F)F |
| InChI | InChI=1S/C10H10F5NO2/c1-16(2)7-4-3-6(18-10(13,14)15)5-8(7)17-9(11)12/h3-5,9H,1-2H3 |
| InChIKey | NDFZLIJQCSFGNR-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.19 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|