2-(difluoromethoxy)-4-(trifluoromethoxy)benzenesulfonyl chloride

C8H4ClF5O4S — CID 170997860

IUPAC2-(difluoromethoxy)-4-(trifluoromethoxy)benzenesulfonyl chloride
SMILESO=S(=O)(Cl)c1ccc(OC(F)(F)F)cc1OC(F)F
InChIInChI=1S/C8H4ClF5O4S/c9-19(15,16)6-2-1-4(18-8(12,13)14)3-5(6)17-7(10)11/h1-3,7H
InChIKeyFNKUJDHILXRUNJ-UHFFFAOYSA-N
MW326.63 g/mol
LogP3.11
Rot. Bonds4

About 2-(difluoromethoxy)-4-(trifluoromethoxy)benzenesulfonyl chloride

2-(difluoromethoxy)-4-(trifluoromethoxy)benzenesulfonyl chloride (PubChem CID 170997860) has the molecular formula C8H4ClF5O4S and a molecular weight of 326.63 g/mol. Its IUPAC name is 2-(difluoromethoxy)-4-(trifluoromethoxy)benzenesulfonyl chloride.

Molecular Properties

Compound Name2-(difluoromethoxy)-4-(trifluoromethoxy)benzenesulfonyl chloride
PubChem CID170997860
Molecular FormulaC8H4ClF5O4S
Molecular Weight326.63 g/mol
Exact Mass325.94
IUPAC Name2-(difluoromethoxy)-4-(trifluoromethoxy)benzenesulfonyl chloride
SMILESO=S(=O)(Cl)c1ccc(OC(F)(F)F)cc1OC(F)F
InChIInChI=1S/C8H4ClF5O4S/c9-19(15,16)6-2-1-4(18-8(12,13)14)3-5(6)17-7(10)11/h1-3,7H
InChIKeyFNKUJDHILXRUNJ-UHFFFAOYSA-N
XLogP3.11
TPSA52.60 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500326.63
LogP ≤ 53.11
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze 2-(difluoromethoxy)-4-(trifluoromethoxy)benzenesulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(difluoromethoxy)-4-(trifluoromethoxy)benzenesulfonyl chloride?
The IUPAC name of 2-(difluoromethoxy)-4-(trifluoromethoxy)benzenesulfonyl chloride (CID 170997860) is 2-(difluoromethoxy)-4-(trifluoromethoxy)benzenesulfonyl chloride.
What is the SMILES notation for 2-(difluoromethoxy)-4-(trifluoromethoxy)benzenesulfonyl chloride?
The canonical SMILES for 2-(difluoromethoxy)-4-(trifluoromethoxy)benzenesulfonyl chloride is O=S(=O)(Cl)c1ccc(OC(F)(F)F)cc1OC(F)F.
What is the InChIKey of 2-(difluoromethoxy)-4-(trifluoromethoxy)benzenesulfonyl chloride?
The InChIKey is FNKUJDHILXRUNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4ClF5O4S/c9-19(15,16)6-2-1-4(18-8(12,13)14)3-5(6)17-7(10)11/h1-3,7H.
What are the key properties of 2-(difluoromethoxy)-4-(trifluoromethoxy)benzenesulfonyl chloride?
2-(difluoromethoxy)-4-(trifluoromethoxy)benzenesulfonyl chloride has a molecular weight of 326.63 g/mol, XLogP of 3.11, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(difluoromethoxy)-4-(trifluoromethoxy)benzenesulfonyl chloride is sourced from PubChem (CID 170997860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).