About 3-(difluoromethoxy)benzenesulfonamide;2-(difluoromethoxy)benzenesulfonyl chloride
3-(difluoromethoxy)benzenesulfonamide;2-(difluoromethoxy)benzenesulfonyl chloride (PubChem CID 158036686) has the molecular formula C14H12ClF4NO6S2
and a molecular weight of 465.83 g/mol. Its IUPAC name is 3-(difluoromethoxy)benzenesulfonamide;2-(difluoromethoxy)benzenesulfonyl chloride.
Molecular Properties
| Compound Name | 3-(difluoromethoxy)benzenesulfonamide;2-(difluoromethoxy)benzenesulfonyl chloride |
| PubChem CID | 158036686 |
| Molecular Formula | C14H12ClF4NO6S2 |
| Molecular Weight | 465.83 g/mol |
| Exact Mass | 464.97 |
| IUPAC Name | 3-(difluoromethoxy)benzenesulfonamide;2-(difluoromethoxy)benzenesulfonyl chloride |
| SMILES | NS(=O)(=O)c1cccc(OC(F)F)c1.O=S(=O)(Cl)c1ccccc1OC(F)F |
| InChI | InChI=1S/C7H5ClF2O3S.C7H7F2NO3S/c8-14(11,12)6-4-2-1-3-5(6)13-7(9)10;8-7(9)13-5-2-1-3-6(4-5)14(10,11)12/h1-4,7H;1-4,7H,(H2,10,11,12) |
| InChIKey | FHVJKADQUCQXIV-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 112.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 465.83 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(difluoromethoxy)benzenesulfonamide;2-(difluoromethoxy)benzenesulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(difluoromethoxy)benzenesulfonamide;2-(difluoromethoxy)benzenesulfonyl chloride?
The IUPAC name of 3-(difluoromethoxy)benzenesulfonamide;2-(difluoromethoxy)benzenesulfonyl chloride (CID 158036686) is 3-(difluoromethoxy)benzenesulfonamide;2-(difluoromethoxy)benzenesulfonyl chloride.
What is the SMILES notation for 3-(difluoromethoxy)benzenesulfonamide;2-(difluoromethoxy)benzenesulfonyl chloride?
The canonical SMILES for 3-(difluoromethoxy)benzenesulfonamide;2-(difluoromethoxy)benzenesulfonyl chloride is NS(=O)(=O)c1cccc(OC(F)F)c1.O=S(=O)(Cl)c1ccccc1OC(F)F.
What is the InChIKey of 3-(difluoromethoxy)benzenesulfonamide;2-(difluoromethoxy)benzenesulfonyl chloride?
The InChIKey is FHVJKADQUCQXIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5ClF2O3S.C7H7F2NO3S/c8-14(11,12)6-4-2-1-3-5(6)13-7(9)10;8-7(9)13-5-2-1-3-6(4-5)14(10,11)12/h1-4,7H;1-4,7H,(H2,10,11,12).
What are the key properties of 3-(difluoromethoxy)benzenesulfonamide;2-(difluoromethoxy)benzenesulfonyl chloride?
3-(difluoromethoxy)benzenesulfonamide;2-(difluoromethoxy)benzenesulfonyl chloride has a molecular weight of 465.83 g/mol, XLogP of 3.15, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(difluoromethoxy)benzenesulfonamide;2-(difluoromethoxy)benzenesulfonyl chloride is sourced from PubChem (CID 158036686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).