C7H8F2N2O3S — CID 112573446
1-(difluoromethoxy)-3-(sulfamoylamino)benzene (PubChem CID 112573446) has the molecular formula C7H8F2N2O3S and a molecular weight of 238.22 g/mol. Its IUPAC name is 1-(difluoromethoxy)-3-(sulfamoylamino)benzene.
| Compound Name | 1-(difluoromethoxy)-3-(sulfamoylamino)benzene |
|---|---|
| PubChem CID | 112573446 |
| Molecular Formula | C7H8F2N2O3S |
| Molecular Weight | 238.22 g/mol |
| Exact Mass | 238.02 |
| IUPAC Name | 1-(difluoromethoxy)-3-(sulfamoylamino)benzene |
| SMILES | NS(=O)(=O)Nc1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C7H8F2N2O3S/c8-7(9)14-6-3-1-2-5(4-6)11-15(10,12)13/h1-4,7,11H,(H2,10,12,13) |
| InChIKey | CRMMOCBRFBSJLH-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.22 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |