C12H15F2NO5S — CID 61460208
methyl 4-[[3-(difluoromethoxy)phenyl]sulfamoyl]butanoate (PubChem CID 61460208) has the molecular formula C12H15F2NO5S and a molecular weight of 323.32 g/mol. Its IUPAC name is methyl 4-[[3-(difluoromethoxy)phenyl]sulfamoyl]butanoate.
| Compound Name | methyl 4-[[3-(difluoromethoxy)phenyl]sulfamoyl]butanoate |
|---|---|
| PubChem CID | 61460208 |
| Molecular Formula | C12H15F2NO5S |
| Molecular Weight | 323.32 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | methyl 4-[[3-(difluoromethoxy)phenyl]sulfamoyl]butanoate |
| SMILES | COC(=O)CCCS(=O)(=O)Nc1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C12H15F2NO5S/c1-19-11(16)6-3-7-21(17,18)15-9-4-2-5-10(8-9)20-12(13)14/h2,4-5,8,12,15H,3,6-7H2,1H3 |
| InChIKey | KVKRHOYLXMDWLX-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.32 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |