C12H14F3NO4S — CID 61460357
methyl 4-[[3-(trifluoromethyl)phenyl]sulfamoyl]butanoate (PubChem CID 61460357) has the molecular formula C12H14F3NO4S and a molecular weight of 325.31 g/mol. Its IUPAC name is methyl 4-[[3-(trifluoromethyl)phenyl]sulfamoyl]butanoate.
| Compound Name | methyl 4-[[3-(trifluoromethyl)phenyl]sulfamoyl]butanoate |
|---|---|
| PubChem CID | 61460357 |
| Molecular Formula | C12H14F3NO4S |
| Molecular Weight | 325.31 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | methyl 4-[[3-(trifluoromethyl)phenyl]sulfamoyl]butanoate |
| SMILES | COC(=O)CCCS(=O)(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H14F3NO4S/c1-20-11(17)6-3-7-21(18,19)16-10-5-2-4-9(8-10)12(13,14)15/h2,4-5,8,16H,3,6-7H2,1H3 |
| InChIKey | LQNCMBLMASCDDL-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.31 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |