C13H13F3N2O3S — CID 17197808
methyl 4-oxo-4-[[3-(trifluoromethyl)phenyl]carbamothioylamino]butanoate (PubChem CID 17197808) has the molecular formula C13H13F3N2O3S and a molecular weight of 334.32 g/mol. Its IUPAC name is methyl 4-oxo-4-[[3-(trifluoromethyl)phenyl]carbamothioylamino]butanoate.
| Compound Name | methyl 4-oxo-4-[[3-(trifluoromethyl)phenyl]carbamothioylamino]butanoate |
|---|---|
| PubChem CID | 17197808 |
| Molecular Formula | C13H13F3N2O3S |
| Molecular Weight | 334.32 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | methyl 4-oxo-4-[[3-(trifluoromethyl)phenyl]carbamothioylamino]butanoate |
| SMILES | COC(=O)CCC(=O)NC(=S)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H13F3N2O3S/c1-21-11(20)6-5-10(19)18-12(22)17-9-4-2-3-8(7-9)13(14,15)16/h2-4,7H,5-6H2,1H3,(H2,17,18,19,22) |
| InChIKey | KOPOXIDIHUBBKB-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.32 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|