C24H19ClF3N3O2S — CID 26168311
3-[3-(2-chlorophenyl)propanoylcarbamothioylamino]-N-[3-(trifluoromethyl)phenyl]benzamide (PubChem CID 26168311) has the molecular formula C24H19ClF3N3O2S and a molecular weight of 505.95 g/mol. Its IUPAC name is 3-[3-(2-chlorophenyl)propanoylcarbamothioylamino]-N-[3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 3-[3-(2-chlorophenyl)propanoylcarbamothioylamino]-N-[3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 26168311 |
| Molecular Formula | C24H19ClF3N3O2S |
| Molecular Weight | 505.95 g/mol |
| Exact Mass | 505.08 |
| IUPAC Name | 3-[3-(2-chlorophenyl)propanoylcarbamothioylamino]-N-[3-(trifluoromethyl)phenyl]benzamide |
| SMILES | O=C(CCc1ccccc1Cl)NC(=S)Nc1cccc(C(=O)Nc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C24H19ClF3N3O2S/c25-20-10-2-1-5-15(20)11-12-21(32)31-23(34)30-18-8-3-6-16(13-18)22(33)29-19-9-4-7-17(14-19)24(26,27)28/h1-10,13-14H,11-12H2,(H,29,33)(H2,30,31,32,34) |
| InChIKey | GNDKQGXWHVEMGC-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.95 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|