C23H20F3N3O2 — CID 54795446
3-[3-(2-aminophenyl)propanoylamino]-N-[3-(trifluoromethyl)phenyl]benzamide (PubChem CID 54795446) has the molecular formula C23H20F3N3O2 and a molecular weight of 427.43 g/mol. Its IUPAC name is 3-[3-(2-aminophenyl)propanoylamino]-N-[3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 3-[3-(2-aminophenyl)propanoylamino]-N-[3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 54795446 |
| Molecular Formula | C23H20F3N3O2 |
| Molecular Weight | 427.43 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | 3-[3-(2-aminophenyl)propanoylamino]-N-[3-(trifluoromethyl)phenyl]benzamide |
| SMILES | Nc1ccccc1CCC(=O)Nc1cccc(C(=O)Nc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C23H20F3N3O2/c24-23(25,26)17-7-4-9-19(14-17)29-22(31)16-6-3-8-18(13-16)28-21(30)12-11-15-5-1-2-10-20(15)27/h1-10,13-14H,11-12,27H2,(H,28,30)(H,29,31) |
| InChIKey | KOHGVQLABJNNLN-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.43 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|