C22H16ClF3N2O2 — CID 18289509
3-[[2-(2-chlorophenyl)acetyl]amino]-N-[3-(trifluoromethyl)phenyl]benzamide (PubChem CID 18289509) has the molecular formula C22H16ClF3N2O2 and a molecular weight of 432.83 g/mol. Its IUPAC name is 3-[[2-(2-chlorophenyl)acetyl]amino]-N-[3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 3-[[2-(2-chlorophenyl)acetyl]amino]-N-[3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 18289509 |
| Molecular Formula | C22H16ClF3N2O2 |
| Molecular Weight | 432.83 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | 3-[[2-(2-chlorophenyl)acetyl]amino]-N-[3-(trifluoromethyl)phenyl]benzamide |
| SMILES | O=C(Cc1ccccc1Cl)Nc1cccc(C(=O)Nc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C22H16ClF3N2O2/c23-19-10-2-1-5-14(19)12-20(29)27-17-8-3-6-15(11-17)21(30)28-18-9-4-7-16(13-18)22(24,25)26/h1-11,13H,12H2,(H,27,29)(H,28,30) |
| InChIKey | JCUPAFYGYCJCIY-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.83 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |