C23H17ClF3N3O3 — CID 24615496
2-chloro-N-[2-oxo-2-[3-[[3-(trifluoromethyl)phenyl]carbamoyl]anilino]ethyl]benzamide (PubChem CID 24615496) has the molecular formula C23H17ClF3N3O3 and a molecular weight of 475.85 g/mol. Its IUPAC name is 2-chloro-N-[2-oxo-2-[3-[[3-(trifluoromethyl)phenyl]carbamoyl]anilino]ethyl]benzamide.
| Compound Name | 2-chloro-N-[2-oxo-2-[3-[[3-(trifluoromethyl)phenyl]carbamoyl]anilino]ethyl]benzamide |
|---|---|
| PubChem CID | 24615496 |
| Molecular Formula | C23H17ClF3N3O3 |
| Molecular Weight | 475.85 g/mol |
| Exact Mass | 475.09 |
| IUPAC Name | 2-chloro-N-[2-oxo-2-[3-[[3-(trifluoromethyl)phenyl]carbamoyl]anilino]ethyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccccc1Cl)Nc1cccc(C(=O)Nc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C23H17ClF3N3O3/c24-19-10-2-1-9-18(19)22(33)28-13-20(31)29-16-7-3-5-14(11-16)21(32)30-17-8-4-6-15(12-17)23(25,26)27/h1-12H,13H2,(H,28,33)(H,29,31)(H,30,32) |
| InChIKey | SBGPSELROWQWGR-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.85 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |