C16H11F5N2O2 — CID 55529533
2,4-difluoro-N-[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl]benzamide (PubChem CID 55529533) has the molecular formula C16H11F5N2O2 and a molecular weight of 358.27 g/mol. Its IUPAC name is 2,4-difluoro-N-[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl]benzamide.
| Compound Name | 2,4-difluoro-N-[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl]benzamide |
|---|---|
| PubChem CID | 55529533 |
| Molecular Formula | C16H11F5N2O2 |
| Molecular Weight | 358.27 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | 2,4-difluoro-N-[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccc(F)cc1F)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H11F5N2O2/c17-10-4-5-12(13(18)7-10)15(25)22-8-14(24)23-11-3-1-2-9(6-11)16(19,20)21/h1-7H,8H2,(H,22,25)(H,23,24) |
| InChIKey | KZTLVEVUYABBSP-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.27 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |