C14H13F3N4O2 — CID 91945715
1-methyl-N-[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl]pyrazole-3-carboxamide (PubChem CID 91945715) has the molecular formula C14H13F3N4O2 and a molecular weight of 326.28 g/mol. Its IUPAC name is 1-methyl-N-[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl]pyrazole-3-carboxamide.
| Compound Name | 1-methyl-N-[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 91945715 |
| Molecular Formula | C14H13F3N4O2 |
| Molecular Weight | 326.28 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 1-methyl-N-[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl]pyrazole-3-carboxamide |
| SMILES | Cn1ccc(C(=O)NCC(=O)Nc2cccc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C14H13F3N4O2/c1-21-6-5-11(20-21)13(23)18-8-12(22)19-10-4-2-3-9(7-10)14(15,16)17/h2-7H,8H2,1H3,(H,18,23)(H,19,22) |
| InChIKey | HLVHOFCIRNQYSD-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.28 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |