C9H7BF3NO — CID 89006052
CID 89006052 (PubChem CID 89006052) has the molecular formula C9H7BF3NO and a molecular weight of 212.97 g/mol.
| Compound Name | CID 89006052 |
|---|---|
| PubChem CID | 89006052 |
| Molecular Formula | C9H7BF3NO |
| Molecular Weight | 212.97 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | — |
| SMILES | [B]CC(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C9H7BF3NO/c10-5-8(15)14-7-3-1-2-6(4-7)9(11,12)13/h1-4H,5H2,(H,14,15) |
| InChIKey | NHYZVFHPERETIL-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.97 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|