C18H15F3N2O3 — CID 108956065
N-(4-acetylphenyl)-N'-[3-(trifluoromethyl)phenyl]propanediamide (PubChem CID 108956065) has the molecular formula C18H15F3N2O3 and a molecular weight of 364.32 g/mol. Its IUPAC name is N-(4-acetylphenyl)-N'-[3-(trifluoromethyl)phenyl]propanediamide.
| Compound Name | N-(4-acetylphenyl)-N'-[3-(trifluoromethyl)phenyl]propanediamide |
|---|---|
| PubChem CID | 108956065 |
| Molecular Formula | C18H15F3N2O3 |
| Molecular Weight | 364.32 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | N-(4-acetylphenyl)-N'-[3-(trifluoromethyl)phenyl]propanediamide |
| SMILES | CC(=O)c1ccc(NC(=O)CC(=O)Nc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C18H15F3N2O3/c1-11(24)12-5-7-14(8-6-12)22-16(25)10-17(26)23-15-4-2-3-13(9-15)18(19,20)21/h2-9H,10H2,1H3,(H,22,25)(H,23,26) |
| InChIKey | VFKVSRVRDFVMNN-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.32 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|