C20H18F6N2O2 — CID 5058568
N,N'-bis[3-(trifluoromethyl)phenyl]hexanediamide (PubChem CID 5058568) has the molecular formula C20H18F6N2O2 and a molecular weight of 432.36 g/mol. Its IUPAC name is N,N'-bis[3-(trifluoromethyl)phenyl]hexanediamide.
| Compound Name | N,N'-bis[3-(trifluoromethyl)phenyl]hexanediamide |
|---|---|
| PubChem CID | 5058568 |
| Molecular Formula | C20H18F6N2O2 |
| Molecular Weight | 432.36 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | N,N'-bis[3-(trifluoromethyl)phenyl]hexanediamide |
| SMILES | O=C(CCCCC(=O)Nc1cccc(C(F)(F)F)c1)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H18F6N2O2/c21-19(22,23)13-5-3-7-15(11-13)27-17(29)9-1-2-10-18(30)28-16-8-4-6-14(12-16)20(24,25)26/h3-8,11-12H,1-2,9-10H2,(H,27,29)(H,28,30) |
| InChIKey | VNDLRGXMLUZCHA-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.36 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|