C16H14F3NO3S — CID 4286052
3-(benzenesulfonyl)-N-[3-(trifluoromethyl)phenyl]propanamide (PubChem CID 4286052) has the molecular formula C16H14F3NO3S and a molecular weight of 357.35 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-N-[3-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 3-(benzenesulfonyl)-N-[3-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 4286052 |
| Molecular Formula | C16H14F3NO3S |
| Molecular Weight | 357.35 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | 3-(benzenesulfonyl)-N-[3-(trifluoromethyl)phenyl]propanamide |
| SMILES | O=C(CCS(=O)(=O)c1ccccc1)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H14F3NO3S/c17-16(18,19)12-5-4-6-13(11-12)20-15(21)9-10-24(22,23)14-7-2-1-3-8-14/h1-8,11H,9-10H2,(H,20,21) |
| InChIKey | AWSAHNDAGGJGCX-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.35 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |