C20H18F6N2O2S — CID 3619896
3-[3-oxo-3-[3-(trifluoromethyl)anilino]propyl]sulfanyl-N-[3-(trifluoromethyl)phenyl]propanamide (PubChem CID 3619896) has the molecular formula C20H18F6N2O2S and a molecular weight of 464.43 g/mol. Its IUPAC name is 3-[3-oxo-3-[3-(trifluoromethyl)anilino]propyl]sulfanyl-N-[3-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 3-[3-oxo-3-[3-(trifluoromethyl)anilino]propyl]sulfanyl-N-[3-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 3619896 |
| Molecular Formula | C20H18F6N2O2S |
| Molecular Weight | 464.43 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | 3-[3-oxo-3-[3-(trifluoromethyl)anilino]propyl]sulfanyl-N-[3-(trifluoromethyl)phenyl]propanamide |
| SMILES | O=C(CCSCCC(=O)Nc1cccc(C(F)(F)F)c1)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H18F6N2O2S/c21-19(22,23)13-3-1-5-15(11-13)27-17(29)7-9-31-10-8-18(30)28-16-6-2-4-14(12-16)20(24,25)26/h1-6,11-12H,7-10H2,(H,27,29)(H,28,30) |
| InChIKey | CBOINDWEAFPCSW-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.43 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|