C14H12F3NO2 — CID 8762528
3-(furan-2-yl)-N-[3-(trifluoromethyl)phenyl]propanamide (PubChem CID 8762528) has the molecular formula C14H12F3NO2 and a molecular weight of 283.25 g/mol. Its IUPAC name is 3-(furan-2-yl)-N-[3-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 3-(furan-2-yl)-N-[3-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 8762528 |
| Molecular Formula | C14H12F3NO2 |
| Molecular Weight | 283.25 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 3-(furan-2-yl)-N-[3-(trifluoromethyl)phenyl]propanamide |
| SMILES | O=C(CCc1ccco1)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H12F3NO2/c15-14(16,17)10-3-1-4-11(9-10)18-13(19)7-6-12-5-2-8-20-12/h1-5,8-9H,6-7H2,(H,18,19) |
| InChIKey | YDHFKNKXPJUUTL-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.25 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |