C14H14F3NO — CID 83960475
N-[3-(furan-2-yl)propyl]-3-(trifluoromethyl)aniline (PubChem CID 83960475) has the molecular formula C14H14F3NO and a molecular weight of 269.27 g/mol. Its IUPAC name is N-[3-(furan-2-yl)propyl]-3-(trifluoromethyl)aniline.
| Compound Name | N-[3-(furan-2-yl)propyl]-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 83960475 |
| Molecular Formula | C14H14F3NO |
| Molecular Weight | 269.27 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | N-[3-(furan-2-yl)propyl]-3-(trifluoromethyl)aniline |
| SMILES | FC(F)(F)c1cccc(NCCCc2ccco2)c1 |
| InChI | InChI=1S/C14H14F3NO/c15-14(16,17)11-4-1-5-12(10-11)18-8-2-6-13-7-3-9-19-13/h1,3-5,7,9-10,18H,2,6,8H2 |
| InChIKey | QGSKDCDFSLWSDI-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.27 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|