C10H12F3NO3S — CID 134094897
3-[3-(trifluoromethyl)anilino]propane-1-sulfonic acid (PubChem CID 134094897) has the molecular formula C10H12F3NO3S and a molecular weight of 283.27 g/mol. Its IUPAC name is 3-[3-(trifluoromethyl)anilino]propane-1-sulfonic acid.
| Compound Name | 3-[3-(trifluoromethyl)anilino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 134094897 |
| Molecular Formula | C10H12F3NO3S |
| Molecular Weight | 283.27 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 3-[3-(trifluoromethyl)anilino]propane-1-sulfonic acid |
| SMILES | O=S(=O)(O)CCCNc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H12F3NO3S/c11-10(12,13)8-3-1-4-9(7-8)14-5-2-6-18(15,16)17/h1,3-4,7,14H,2,5-6H2,(H,15,16,17) |
| InChIKey | XMKZYWSUXLJODC-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.27 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|