C12H16F3NO3S — CID 87844997
3-[2-[3-(trifluoromethyl)phenyl]ethylamino]propane-1-sulfonic acid (PubChem CID 87844997) has the molecular formula C12H16F3NO3S and a molecular weight of 311.32 g/mol. Its IUPAC name is 3-[2-[3-(trifluoromethyl)phenyl]ethylamino]propane-1-sulfonic acid.
| Compound Name | 3-[2-[3-(trifluoromethyl)phenyl]ethylamino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 87844997 |
| Molecular Formula | C12H16F3NO3S |
| Molecular Weight | 311.32 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | 3-[2-[3-(trifluoromethyl)phenyl]ethylamino]propane-1-sulfonic acid |
| SMILES | O=S(=O)(O)CCCNCCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H16F3NO3S/c13-12(14,15)11-4-1-3-10(9-11)5-7-16-6-2-8-20(17,18)19/h1,3-4,9,16H,2,5-8H2,(H,17,18,19) |
| InChIKey | JBPDWJKPPVQADJ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.32 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|