C13H18F3NO — CID 55134831
N-(2-methoxyethyl)-3-[3-(trifluoromethyl)phenyl]propan-1-amine (PubChem CID 55134831) has the molecular formula C13H18F3NO and a molecular weight of 261.29 g/mol. Its IUPAC name is N-(2-methoxyethyl)-3-[3-(trifluoromethyl)phenyl]propan-1-amine.
| Compound Name | N-(2-methoxyethyl)-3-[3-(trifluoromethyl)phenyl]propan-1-amine |
|---|---|
| PubChem CID | 55134831 |
| Molecular Formula | C13H18F3NO |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | N-(2-methoxyethyl)-3-[3-(trifluoromethyl)phenyl]propan-1-amine |
| SMILES | COCCNCCCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H18F3NO/c1-18-9-8-17-7-3-5-11-4-2-6-12(10-11)13(14,15)16/h2,4,6,10,17H,3,5,7-9H2,1H3 |
| InChIKey | PQTXFIWGXNUWDB-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|