C16H24F3NO — CID 62596429
2-ethyl-N-(2-methoxyethyl)-2-[3-(trifluoromethyl)phenyl]butan-1-amine (PubChem CID 62596429) has the molecular formula C16H24F3NO and a molecular weight of 303.37 g/mol. Its IUPAC name is 2-ethyl-N-(2-methoxyethyl)-2-[3-(trifluoromethyl)phenyl]butan-1-amine.
| Compound Name | 2-ethyl-N-(2-methoxyethyl)-2-[3-(trifluoromethyl)phenyl]butan-1-amine |
|---|---|
| PubChem CID | 62596429 |
| Molecular Formula | C16H24F3NO |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | 2-ethyl-N-(2-methoxyethyl)-2-[3-(trifluoromethyl)phenyl]butan-1-amine |
| SMILES | CCC(CC)(CNCCOC)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H24F3NO/c1-4-15(5-2,12-20-9-10-21-3)13-7-6-8-14(11-13)16(17,18)19/h6-8,11,20H,4-5,9-10,12H2,1-3H3 |
| InChIKey | NYXXASIGDVSDJF-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|