C16H24F3N — CID 63511400
2-ethyl-N-propan-2-yl-2-[3-(trifluoromethyl)phenyl]butan-1-amine (PubChem CID 63511400) has the molecular formula C16H24F3N and a molecular weight of 287.37 g/mol. Its IUPAC name is 2-ethyl-N-propan-2-yl-2-[3-(trifluoromethyl)phenyl]butan-1-amine.
| Compound Name | 2-ethyl-N-propan-2-yl-2-[3-(trifluoromethyl)phenyl]butan-1-amine |
|---|---|
| PubChem CID | 63511400 |
| Molecular Formula | C16H24F3N |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | 2-ethyl-N-propan-2-yl-2-[3-(trifluoromethyl)phenyl]butan-1-amine |
| SMILES | CCC(CC)(CNC(C)C)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H24F3N/c1-5-15(6-2,11-20-12(3)4)13-8-7-9-14(10-13)16(17,18)19/h7-10,12,20H,5-6,11H2,1-4H3 |
| InChIKey | RQUHTPVRLICBSR-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |