C15H22F3N — CID 60819147
3-methyl-N-propyl-1-[3-(trifluoromethyl)phenyl]butan-1-amine (PubChem CID 60819147) has the molecular formula C15H22F3N and a molecular weight of 273.34 g/mol. Its IUPAC name is 3-methyl-N-propyl-1-[3-(trifluoromethyl)phenyl]butan-1-amine.
| Compound Name | 3-methyl-N-propyl-1-[3-(trifluoromethyl)phenyl]butan-1-amine |
|---|---|
| PubChem CID | 60819147 |
| Molecular Formula | C15H22F3N |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | 3-methyl-N-propyl-1-[3-(trifluoromethyl)phenyl]butan-1-amine |
| SMILES | CCCNC(CC(C)C)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H22F3N/c1-4-8-19-14(9-11(2)3)12-6-5-7-13(10-12)15(16,17)18/h5-7,10-11,14,19H,4,8-9H2,1-3H3 |
| InChIKey | SHUUNDVPFCADHO-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |