C16H24F3NS — CID 64612803
N-[2-butan-2-ylsulfanyl-1-[3-(trifluoromethyl)phenyl]ethyl]propan-1-amine (PubChem CID 64612803) has the molecular formula C16H24F3NS and a molecular weight of 319.44 g/mol. Its IUPAC name is N-[2-butan-2-ylsulfanyl-1-[3-(trifluoromethyl)phenyl]ethyl]propan-1-amine.
| Compound Name | N-[2-butan-2-ylsulfanyl-1-[3-(trifluoromethyl)phenyl]ethyl]propan-1-amine |
|---|---|
| PubChem CID | 64612803 |
| Molecular Formula | C16H24F3NS |
| Molecular Weight | 319.44 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | N-[2-butan-2-ylsulfanyl-1-[3-(trifluoromethyl)phenyl]ethyl]propan-1-amine |
| SMILES | CCCNC(CSC(C)CC)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H24F3NS/c1-4-9-20-15(11-21-12(3)5-2)13-7-6-8-14(10-13)16(17,18)19/h6-8,10,12,15,20H,4-5,9,11H2,1-3H3 |
| InChIKey | NAKDHGSSYGHONG-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.44 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |