C14H20F3NOS — CID 64652133
N-[2-ethylsulfinyl-1-[3-(trifluoromethyl)phenyl]ethyl]propan-1-amine (PubChem CID 64652133) has the molecular formula C14H20F3NOS and a molecular weight of 307.38 g/mol. Its IUPAC name is N-[2-ethylsulfinyl-1-[3-(trifluoromethyl)phenyl]ethyl]propan-1-amine.
| Compound Name | N-[2-ethylsulfinyl-1-[3-(trifluoromethyl)phenyl]ethyl]propan-1-amine |
|---|---|
| PubChem CID | 64652133 |
| Molecular Formula | C14H20F3NOS |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | N-[2-ethylsulfinyl-1-[3-(trifluoromethyl)phenyl]ethyl]propan-1-amine |
| SMILES | CCCNC(CS(=O)CC)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H20F3NOS/c1-3-8-18-13(10-20(19)4-2)11-6-5-7-12(9-11)14(15,16)17/h5-7,9,13,18H,3-4,8,10H2,1-2H3 |
| InChIKey | ZFYFZXUQGHZRHW-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |