C14H20F3NOS — CID 64651105
2-tert-butylsulfinyl-N-methyl-1-[3-(trifluoromethyl)phenyl]ethanamine (PubChem CID 64651105) has the molecular formula C14H20F3NOS and a molecular weight of 307.38 g/mol. Its IUPAC name is 2-tert-butylsulfinyl-N-methyl-1-[3-(trifluoromethyl)phenyl]ethanamine.
| Compound Name | 2-tert-butylsulfinyl-N-methyl-1-[3-(trifluoromethyl)phenyl]ethanamine |
|---|---|
| PubChem CID | 64651105 |
| Molecular Formula | C14H20F3NOS |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 2-tert-butylsulfinyl-N-methyl-1-[3-(trifluoromethyl)phenyl]ethanamine |
| SMILES | CNC(CS(=O)C(C)(C)C)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H20F3NOS/c1-13(2,3)20(19)9-12(18-4)10-6-5-7-11(8-10)14(15,16)17/h5-8,12,18H,9H2,1-4H3 |
| InChIKey | ACKPXPGLTHAZBR-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |