C13H18F3NO — CID 112688216
3-ethoxy-N-methyl-1-[3-(trifluoromethyl)phenyl]propan-1-amine (PubChem CID 112688216) has the molecular formula C13H18F3NO and a molecular weight of 261.29 g/mol. Its IUPAC name is 3-ethoxy-N-methyl-1-[3-(trifluoromethyl)phenyl]propan-1-amine.
| Compound Name | 3-ethoxy-N-methyl-1-[3-(trifluoromethyl)phenyl]propan-1-amine |
|---|---|
| PubChem CID | 112688216 |
| Molecular Formula | C13H18F3NO |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 3-ethoxy-N-methyl-1-[3-(trifluoromethyl)phenyl]propan-1-amine |
| SMILES | CCOCCC(NC)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H18F3NO/c1-3-18-8-7-12(17-2)10-5-4-6-11(9-10)13(14,15)16/h4-6,9,12,17H,3,7-8H2,1-2H3 |
| InChIKey | WVDMQYQJYLZXCQ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|