C18H18F6N2 — CID 14342384
N,N'-dimethyl-1,2-bis[3-(trifluoromethyl)phenyl]ethane-1,2-diamine (PubChem CID 14342384) has the molecular formula C18H18F6N2 and a molecular weight of 376.34 g/mol. Its IUPAC name is N,N'-dimethyl-1,2-bis[3-(trifluoromethyl)phenyl]ethane-1,2-diamine.
| Compound Name | N,N'-dimethyl-1,2-bis[3-(trifluoromethyl)phenyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 14342384 |
| Molecular Formula | C18H18F6N2 |
| Molecular Weight | 376.34 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | N,N'-dimethyl-1,2-bis[3-(trifluoromethyl)phenyl]ethane-1,2-diamine |
| SMILES | CNC(c1cccc(C(F)(F)F)c1)C(NC)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H18F6N2/c1-25-15(11-5-3-7-13(9-11)17(19,20)21)16(26-2)12-6-4-8-14(10-12)18(22,23)24/h3-10,15-16,25-26H,1-2H3 |
| InChIKey | SBGOGHODWUZHIY-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.34 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |