C16H22F3N — CID 65399168
1-cycloheptyl-N-methyl-1-[3-(trifluoromethyl)phenyl]methanamine (PubChem CID 65399168) has the molecular formula C16H22F3N and a molecular weight of 285.35 g/mol. Its IUPAC name is 1-cycloheptyl-N-methyl-1-[3-(trifluoromethyl)phenyl]methanamine.
| Compound Name | 1-cycloheptyl-N-methyl-1-[3-(trifluoromethyl)phenyl]methanamine |
|---|---|
| PubChem CID | 65399168 |
| Molecular Formula | C16H22F3N |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 1-cycloheptyl-N-methyl-1-[3-(trifluoromethyl)phenyl]methanamine |
| SMILES | CNC(c1cccc(C(F)(F)F)c1)C1CCCCCC1 |
| InChI | InChI=1S/C16H22F3N/c1-20-15(12-7-4-2-3-5-8-12)13-9-6-10-14(11-13)16(17,18)19/h6,9-12,15,20H,2-5,7-8H2,1H3 |
| InChIKey | HSIWQXDVHMVRCN-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |