C17H24F3N — CID 81390965
(1S)-1-cyclohexyl-N-[1-[3-(trifluoromethyl)phenyl]ethyl]ethanamine (PubChem CID 81390965) has the molecular formula C17H24F3N and a molecular weight of 299.38 g/mol. Its IUPAC name is (1S)-1-cyclohexyl-N-[1-[3-(trifluoromethyl)phenyl]ethyl]ethanamine.
| Compound Name | (1S)-1-cyclohexyl-N-[1-[3-(trifluoromethyl)phenyl]ethyl]ethanamine |
|---|---|
| PubChem CID | 81390965 |
| Molecular Formula | C17H24F3N |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | (1S)-1-cyclohexyl-N-[1-[3-(trifluoromethyl)phenyl]ethyl]ethanamine |
| SMILES | CC(N[C@@H](C)C1CCCCC1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H24F3N/c1-12(14-7-4-3-5-8-14)21-13(2)15-9-6-10-16(11-15)17(18,19)20/h6,9-14,21H,3-5,7-8H2,1-2H3/t12-,13?/m0/s1 |
| InChIKey | TYAGBFKDEIIETQ-UEWDXFNNSA-N |
| XLogP | 5.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |