C16H20F3NO — CID 112764056
N-[1-[3-(trifluoromethyl)phenyl]ethyl]cyclohexanecarboxamide (PubChem CID 112764056) has the molecular formula C16H20F3NO and a molecular weight of 299.34 g/mol. Its IUPAC name is N-[1-[3-(trifluoromethyl)phenyl]ethyl]cyclohexanecarboxamide.
| Compound Name | N-[1-[3-(trifluoromethyl)phenyl]ethyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 112764056 |
| Molecular Formula | C16H20F3NO |
| Molecular Weight | 299.34 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | N-[1-[3-(trifluoromethyl)phenyl]ethyl]cyclohexanecarboxamide |
| SMILES | CC(NC(=O)C1CCCCC1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H20F3NO/c1-11(20-15(21)12-6-3-2-4-7-12)13-8-5-9-14(10-13)16(17,18)19/h5,8-12H,2-4,6-7H2,1H3,(H,20,21) |
| InChIKey | NTIGFSUVJKNRFR-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.34 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |