C15H19F3N2O — CID 66009151
3-amino-N-[1-[3-(trifluoromethyl)phenyl]ethyl]cyclopentane-1-carboxamide (PubChem CID 66009151) has the molecular formula C15H19F3N2O and a molecular weight of 300.32 g/mol. Its IUPAC name is 3-amino-N-[1-[3-(trifluoromethyl)phenyl]ethyl]cyclopentane-1-carboxamide.
| Compound Name | 3-amino-N-[1-[3-(trifluoromethyl)phenyl]ethyl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 66009151 |
| Molecular Formula | C15H19F3N2O |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 3-amino-N-[1-[3-(trifluoromethyl)phenyl]ethyl]cyclopentane-1-carboxamide |
| SMILES | CC(NC(=O)C1CCC(N)C1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H19F3N2O/c1-9(20-14(21)11-5-6-13(19)8-11)10-3-2-4-12(7-10)15(16,17)18/h2-4,7,9,11,13H,5-6,8,19H2,1H3,(H,20,21) |
| InChIKey | UHJMIZNCSHHPIF-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |