C16H22F3N — CID 103561386
3-propan-2-yl-N-[1-[3-(trifluoromethyl)phenyl]ethyl]cyclobutan-1-amine (PubChem CID 103561386) has the molecular formula C16H22F3N and a molecular weight of 285.35 g/mol. Its IUPAC name is 3-propan-2-yl-N-[1-[3-(trifluoromethyl)phenyl]ethyl]cyclobutan-1-amine.
| Compound Name | 3-propan-2-yl-N-[1-[3-(trifluoromethyl)phenyl]ethyl]cyclobutan-1-amine |
|---|---|
| PubChem CID | 103561386 |
| Molecular Formula | C16H22F3N |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 3-propan-2-yl-N-[1-[3-(trifluoromethyl)phenyl]ethyl]cyclobutan-1-amine |
| SMILES | CC(NC1CC(C(C)C)C1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H22F3N/c1-10(2)13-8-15(9-13)20-11(3)12-5-4-6-14(7-12)16(17,18)19/h4-7,10-11,13,15,20H,8-9H2,1-3H3 |
| InChIKey | QTEVRQFZHXDENR-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |