C16H21F3N2 — CID 43195070
N-[1-[3-(trifluoromethyl)phenyl]ethyl]-1-azabicyclo[2.2.2]octan-3-amine (PubChem CID 43195070) has the molecular formula C16H21F3N2 and a molecular weight of 298.35 g/mol. Its IUPAC name is N-[1-[3-(trifluoromethyl)phenyl]ethyl]-1-azabicyclo[2.2.2]octan-3-amine.
| Compound Name | N-[1-[3-(trifluoromethyl)phenyl]ethyl]-1-azabicyclo[2.2.2]octan-3-amine |
|---|---|
| PubChem CID | 43195070 |
| Molecular Formula | C16H21F3N2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | N-[1-[3-(trifluoromethyl)phenyl]ethyl]-1-azabicyclo[2.2.2]octan-3-amine |
| SMILES | CC(NC1CN2CCC1CC2)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H21F3N2/c1-11(13-3-2-4-14(9-13)16(17,18)19)20-15-10-21-7-5-12(15)6-8-21/h2-4,9,11-12,15,20H,5-8,10H2,1H3 |
| InChIKey | ZJQLKEJKSLZNOC-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |