C15H20F3NS — CID 103786809
3-methylsulfanyl-N-[1-[3-(trifluoromethyl)phenyl]ethyl]cyclopentan-1-amine (PubChem CID 103786809) has the molecular formula C15H20F3NS and a molecular weight of 303.39 g/mol. Its IUPAC name is 3-methylsulfanyl-N-[1-[3-(trifluoromethyl)phenyl]ethyl]cyclopentan-1-amine.
| Compound Name | 3-methylsulfanyl-N-[1-[3-(trifluoromethyl)phenyl]ethyl]cyclopentan-1-amine |
|---|---|
| PubChem CID | 103786809 |
| Molecular Formula | C15H20F3NS |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 3-methylsulfanyl-N-[1-[3-(trifluoromethyl)phenyl]ethyl]cyclopentan-1-amine |
| SMILES | CSC1CCC(NC(C)c2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C15H20F3NS/c1-10(19-13-6-7-14(9-13)20-2)11-4-3-5-12(8-11)15(16,17)18/h3-5,8,10,13-14,19H,6-7,9H2,1-2H3 |
| InChIKey | DHWRRSPFJXAOIG-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |