C15H21F2NOS — CID 103711220
N-[1-[4-(difluoromethoxy)phenyl]ethyl]-3-methylsulfanylcyclopentan-1-amine (PubChem CID 103711220) has the molecular formula C15H21F2NOS and a molecular weight of 301.40 g/mol. Its IUPAC name is N-[1-[4-(difluoromethoxy)phenyl]ethyl]-3-methylsulfanylcyclopentan-1-amine.
| Compound Name | N-[1-[4-(difluoromethoxy)phenyl]ethyl]-3-methylsulfanylcyclopentan-1-amine |
|---|---|
| PubChem CID | 103711220 |
| Molecular Formula | C15H21F2NOS |
| Molecular Weight | 301.40 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | N-[1-[4-(difluoromethoxy)phenyl]ethyl]-3-methylsulfanylcyclopentan-1-amine |
| SMILES | CSC1CCC(NC(C)c2ccc(OC(F)F)cc2)C1 |
| InChI | InChI=1S/C15H21F2NOS/c1-10(18-12-5-8-14(9-12)20-2)11-3-6-13(7-4-11)19-15(16)17/h3-4,6-7,10,12,14-15,18H,5,8-9H2,1-2H3 |
| InChIKey | NMSLQBWGGJXVCW-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.40 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |