C14H21NO2S — CID 114122802
2-[1-[(3-methylsulfanylcyclopentyl)amino]ethyl]benzene-1,4-diol (PubChem CID 114122802) has the molecular formula C14H21NO2S and a molecular weight of 267.39 g/mol. Its IUPAC name is 2-[1-[(3-methylsulfanylcyclopentyl)amino]ethyl]benzene-1,4-diol.
| Compound Name | 2-[1-[(3-methylsulfanylcyclopentyl)amino]ethyl]benzene-1,4-diol |
|---|---|
| PubChem CID | 114122802 |
| Molecular Formula | C14H21NO2S |
| Molecular Weight | 267.39 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 2-[1-[(3-methylsulfanylcyclopentyl)amino]ethyl]benzene-1,4-diol |
| SMILES | CSC1CCC(NC(C)c2cc(O)ccc2O)C1 |
| InChI | InChI=1S/C14H21NO2S/c1-9(13-8-11(16)4-6-14(13)17)15-10-3-5-12(7-10)18-2/h4,6,8-10,12,15-17H,3,5,7H2,1-2H3 |
| InChIKey | YSDSBYDUHBGSGC-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.39 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|