C15H23NO2S2 — CID 103786848
3-methylsulfanyl-N-[1-(4-methylsulfonylphenyl)ethyl]cyclopentan-1-amine (PubChem CID 103786848) has the molecular formula C15H23NO2S2 and a molecular weight of 313.49 g/mol. Its IUPAC name is 3-methylsulfanyl-N-[1-(4-methylsulfonylphenyl)ethyl]cyclopentan-1-amine.
| Compound Name | 3-methylsulfanyl-N-[1-(4-methylsulfonylphenyl)ethyl]cyclopentan-1-amine |
|---|---|
| PubChem CID | 103786848 |
| Molecular Formula | C15H23NO2S2 |
| Molecular Weight | 313.49 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 3-methylsulfanyl-N-[1-(4-methylsulfonylphenyl)ethyl]cyclopentan-1-amine |
| SMILES | CSC1CCC(NC(C)c2ccc(S(C)(=O)=O)cc2)C1 |
| InChI | InChI=1S/C15H23NO2S2/c1-11(16-13-6-7-14(10-13)19-2)12-4-8-15(9-5-12)20(3,17)18/h4-5,8-9,11,13-14,16H,6-7,10H2,1-3H3 |
| InChIKey | GYTUPVIPPGWJQA-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.49 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |