C15H24N2O2S2 — CID 97113685
4-[(1S)-1-[[(1S,3R)-3-ethylsulfanylcyclopentyl]amino]ethyl]benzenesulfonamide (PubChem CID 97113685) has the molecular formula C15H24N2O2S2 and a molecular weight of 328.50 g/mol. Its IUPAC name is 4-[(1S)-1-[[(1S,3R)-3-ethylsulfanylcyclopentyl]amino]ethyl]benzenesulfonamide.
| Compound Name | 4-[(1S)-1-[[(1S,3R)-3-ethylsulfanylcyclopentyl]amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 97113685 |
| Molecular Formula | C15H24N2O2S2 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 4-[(1S)-1-[[(1S,3R)-3-ethylsulfanylcyclopentyl]amino]ethyl]benzenesulfonamide |
| SMILES | CCS[C@@H]1CC[C@H](N[C@@H](C)c2ccc(S(N)(=O)=O)cc2)C1 |
| InChI | InChI=1S/C15H24N2O2S2/c1-3-20-14-7-6-13(10-14)17-11(2)12-4-8-15(9-5-12)21(16,18)19/h4-5,8-9,11,13-14,17H,3,6-7,10H2,1-2H3,(H2,16,18,19)/t11-,13-,14+/m0/s1 |
| InChIKey | OSDZAUNXMHVQCK-FPMFFAJLSA-N |
| XLogP | 2.66 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |