C14H18F3NO2S — CID 43615085
1,1-dioxo-N-[1-[3-(trifluoromethyl)phenyl]ethyl]thian-4-amine (PubChem CID 43615085) has the molecular formula C14H18F3NO2S and a molecular weight of 321.36 g/mol. Its IUPAC name is 1,1-dioxo-N-[1-[3-(trifluoromethyl)phenyl]ethyl]thian-4-amine.
| Compound Name | 1,1-dioxo-N-[1-[3-(trifluoromethyl)phenyl]ethyl]thian-4-amine |
|---|---|
| PubChem CID | 43615085 |
| Molecular Formula | C14H18F3NO2S |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 1,1-dioxo-N-[1-[3-(trifluoromethyl)phenyl]ethyl]thian-4-amine |
| SMILES | CC(NC1CCS(=O)(=O)CC1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H18F3NO2S/c1-10(18-13-5-7-21(19,20)8-6-13)11-3-2-4-12(9-11)14(15,16)17/h2-4,9-10,13,18H,5-8H2,1H3 |
| InChIKey | MPYNZWJBCNKNSJ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |