C12H14F3NO2S — CID 43511458
1,1-dioxo-N-[3-(trifluoromethyl)phenyl]thian-4-amine (PubChem CID 43511458) has the molecular formula C12H14F3NO2S and a molecular weight of 293.31 g/mol. Its IUPAC name is 1,1-dioxo-N-[3-(trifluoromethyl)phenyl]thian-4-amine.
| Compound Name | 1,1-dioxo-N-[3-(trifluoromethyl)phenyl]thian-4-amine |
|---|---|
| PubChem CID | 43511458 |
| Molecular Formula | C12H14F3NO2S |
| Molecular Weight | 293.31 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 1,1-dioxo-N-[3-(trifluoromethyl)phenyl]thian-4-amine |
| SMILES | O=S1(=O)CCC(Nc2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C12H14F3NO2S/c13-12(14,15)9-2-1-3-11(8-9)16-10-4-6-19(17,18)7-5-10/h1-3,8,10,16H,4-7H2 |
| InChIKey | PJZJTMVOIGRHAF-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.31 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |