C12H13BrF3NO2S — CID 115511498
N-[2-bromo-4-(trifluoromethyl)phenyl]-1,1-dioxothian-4-amine (PubChem CID 115511498) has the molecular formula C12H13BrF3NO2S and a molecular weight of 372.21 g/mol. Its IUPAC name is N-[2-bromo-4-(trifluoromethyl)phenyl]-1,1-dioxothian-4-amine.
| Compound Name | N-[2-bromo-4-(trifluoromethyl)phenyl]-1,1-dioxothian-4-amine |
|---|---|
| PubChem CID | 115511498 |
| Molecular Formula | C12H13BrF3NO2S |
| Molecular Weight | 372.21 g/mol |
| Exact Mass | 370.98 |
| IUPAC Name | N-[2-bromo-4-(trifluoromethyl)phenyl]-1,1-dioxothian-4-amine |
| SMILES | O=S1(=O)CCC(Nc2ccc(C(F)(F)F)cc2Br)CC1 |
| InChI | InChI=1S/C12H13BrF3NO2S/c13-10-7-8(12(14,15)16)1-2-11(10)17-9-3-5-20(18,19)6-4-9/h1-2,7,9,17H,3-6H2 |
| InChIKey | UAUIRZISWRJZND-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.21 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |