C11H12F3NO2S — CID 7116118
(3R)-1,1-dioxo-N-[3-(trifluoromethyl)phenyl]thiolan-3-amine (PubChem CID 7116118) has the molecular formula C11H12F3NO2S and a molecular weight of 279.28 g/mol. Its IUPAC name is (3R)-1,1-dioxo-N-[3-(trifluoromethyl)phenyl]thiolan-3-amine.
| Compound Name | (3R)-1,1-dioxo-N-[3-(trifluoromethyl)phenyl]thiolan-3-amine |
|---|---|
| PubChem CID | 7116118 |
| Molecular Formula | C11H12F3NO2S |
| Molecular Weight | 279.28 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | (3R)-1,1-dioxo-N-[3-(trifluoromethyl)phenyl]thiolan-3-amine |
| SMILES | O=S1(=O)CC[C@@H](Nc2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C11H12F3NO2S/c12-11(13,14)8-2-1-3-9(6-8)15-10-4-5-18(16,17)7-10/h1-3,6,10,15H,4-5,7H2/t10-/m1/s1 |
| InChIKey | OZAYHWCYJALBAL-SNVBAGLBSA-N |
| XLogP | 2.30 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.28 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |