C12H15F3N2 — CID 62975033
1-methyl-N-[3-(trifluoromethyl)phenyl]pyrrolidin-3-amine (PubChem CID 62975033) has the molecular formula C12H15F3N2 and a molecular weight of 244.26 g/mol. Its IUPAC name is 1-methyl-N-[3-(trifluoromethyl)phenyl]pyrrolidin-3-amine.
| Compound Name | 1-methyl-N-[3-(trifluoromethyl)phenyl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 62975033 |
| Molecular Formula | C12H15F3N2 |
| Molecular Weight | 244.26 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 1-methyl-N-[3-(trifluoromethyl)phenyl]pyrrolidin-3-amine |
| SMILES | CN1CCC(Nc2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C12H15F3N2/c1-17-6-5-11(8-17)16-10-4-2-3-9(7-10)12(13,14)15/h2-4,7,11,16H,5-6,8H2,1H3 |
| InChIKey | XWBUSEGTCBWMBJ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.26 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |